Organophosphorus compounds
Chemscene ChemScene | RuPhos Pd G4 | 1G | CS-0080716 | 0.98 | 1599466-85-9| MFCD28411659 | 850.39
ChemScene | RuPhos Pd G4 | 1G | CS-0080716 | 0.98 | 1599466-85-9| MFCD28411659 | 850.39
Accela Chembio Inc 1 | 3-bis(diphenylphosphino)propane Nickel (ii) Chloride | 50g | 15629-92-2 | MFCD00015318 | 98% | Shelf Life: 1260 Days | N2/+4
1 | 3-bis(diphenylphosphino)propane Nickel (ii) Chloride | 50g | 15629-92-2 | MFCD00015318 | 98% | Shelf Life: 1260 Days | N2/+4
![eMolecules 136552-06-2 | Fmoc-Aze-OH | Ambeed | MFCD01320843 | 323.348 | C19H17NO4 | 97.000 | OC(=O)[C@@H]1CCN1C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 552759769](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502128062.JPG-250.jpg)
eMolecules 136552-06-2 | Fmoc-Aze-OH | Ambeed | MFCD01320843 | 323.348 | C19H17NO4 | 97.000 | OC(=O)[C@@H]1CCN1C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 552759769
Fmoc-Aze-OH | Ambeed | 136552-06-2 | MFCD01320843 | 323.348 | C19H17NO4 | 97.000 | OC(=O)[C@@H]1CCN1C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 552759769
Sigma Aldrich Fine Chemicals Biosciences tBuMePhos | 255837-19-5 | MFCD03453047 | 500MG
tBuMePhos | Mol Wt: 312.43 | 255837-19-5 | MFCD03453047 | 500MG
Pfaltz & Bauer Tetrabutylphosphonium hydroxid 50G | 14518-69-5
Tetrabutylphosphonium hydroxid 50G | 14518-69-5
eMolecules 829-85-6 | Diphenylphosphine | Oakwood Chemicals | MFCD00003040 | 186.194 | C12H11P | 98.000 | P(c1ccccc1)c1ccccc1 | 100g | 480134646
Diphenylphosphine | Oakwood Chemicals | 829-85-6 | MFCD00003040 | 186.194 | C12H11P | 98.000 | P(c1ccccc1)c1ccccc1 | 100g | 480134646
![eMolecules 224311-51-7 | 2-[Bis(tert-butyl)phosphino]biphenyl | Apollo Scientific | MFCD01862440 | 298.410 | C20H27P | 97.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 5g | 562505130](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000483433.jpg-250.jpg)
eMolecules 224311-51-7 | 2-[Bis(tert-butyl)phosphino]biphenyl | Apollo Scientific | MFCD01862440 | 298.410 | C20H27P | 97.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 5g | 562505130
2-[Bis(tert-butyl)phosphino]biphenyl | Apollo Scientific | 224311-51-7 | MFCD01862440 | 298.410 | C20H27P | 97.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 5g | 562505130
![Chemscene ChemScene | 1-((2'-Cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1h-benzo[d]imidazole-7-carboxylic acid | 250MG | CS-0197698 | 0.95 | 632322-61-3| MFCD27996073 | 397.43](https://assets.fishersci.com/TFS-Assets/CCG/product-images/CS-0197698.JPG-250.jpg)
Chemscene ChemScene | 1-((2'-Cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1h-benzo[d]imidazole-7-carboxylic acid | 250MG | CS-0197698 | 0.95 | 632322-61-3| MFCD27996073 | 397.43
ChemScene | 1-((2'-Cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1h-benzo[d]imidazole-7-carboxylic acid | 250MG | CS-0197698 | 0.95 | 632322-61-3| MFCD27996073 | 397.43
Medchemexpress LLC 2-(dicyclohexylphosphino)-2',4',6'-triisopropylbiphenyl | 564483-18-7 | MFCD04117682 | 99.1% | 476.72 | C33H49P | 25g
XPhos is a dual aryl monophosphine ligand XPhos is an efficient and stable palladium catalytic ligand XPhos can be used for amination of aryl sulfonate esters[1][2]
eMolecules 77989-15-2 | 2-(2-Bromophenyl)-4,6-diphenyl-1,3,5-triazine | MFCD29047055 | 1g
Ambeed | 2-(2-Bromophenyl)-4,6-diphenyl-1,3,5-triazine | 1g | 552755459 | A757001 | 77989-15-2 | MFCD29047055 | 388.268 | C21H14BrN3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>